| /* |
| * Copyright 2019 The Android Open Source Project |
| * |
| * Licensed under the Apache License, Version 2.0 (the "License"); |
| * you may not use this file except in compliance with the License. |
| * You may obtain a copy of the License at |
| * |
| * http://www.apache.org/licenses/LICENSE-2.0 |
| * |
| * Unless required by applicable law or agreed to in writing, software |
| * distributed under the License is distributed on an "AS IS" BASIS, |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |
| * See the License for the specific language governing permissions and |
| * limitations under the License. |
| */ |
| |
| package android.security.identity; |
| |
| import android.annotation.NonNull; |
| import android.annotation.Nullable; |
| |
| import java.security.InvalidKeyException; |
| import java.security.KeyPair; |
| import java.security.PublicKey; |
| import java.security.cert.X509Certificate; |
| import java.time.Instant; |
| import java.util.Collection; |
| import java.util.Map; |
| |
| /** |
| * Class used to read data from a previously provisioned credential. |
| * |
| * Use {@link IdentityCredentialStore#getCredentialByName(String, int)} to get a |
| * {@link IdentityCredential} instance. |
| */ |
| public abstract class IdentityCredential { |
| /** |
| * @hide |
| */ |
| protected IdentityCredential() {} |
| |
| /** |
| * Create an ephemeral key pair to use to establish a secure channel with a reader. |
| * |
| * <p>Applications should use this key-pair for the communications channel with the reader |
| * using a protocol / cipher-suite appropriate for the application. One example of such a |
| * protocol is the one used for Mobile Driving Licenses, see ISO 18013-5 section 9.2.1 "Session |
| * encryption". |
| * |
| * @return ephemeral key pair to use to establish a secure channel with a reader. |
| */ |
| public @NonNull abstract KeyPair createEphemeralKeyPair(); |
| |
| /** |
| * Set the ephemeral public key provided by the reader. If called, this must be called before |
| * {@link #getEntries(byte[], Map, byte[], byte[])} is called. |
| * |
| * @param readerEphemeralPublicKey The ephemeral public key provided by the reader to |
| * establish a secure session. |
| * @throws InvalidKeyException if the given key is invalid. |
| */ |
| public abstract void setReaderEphemeralPublicKey(@NonNull PublicKey readerEphemeralPublicKey) |
| throws InvalidKeyException; |
| |
| /** |
| * Encrypt a message for transmission to the reader. |
| * |
| * <p>Do not use. In this version of the API, this method produces an incorrect |
| * result. Instead, applications should implement message encryption/decryption themselves as |
| * detailed in the {@link #createEphemeralKeyPair()} method. In a future API-level, this |
| * method will be deprecated. |
| * |
| * @param messagePlaintext unencrypted message to encrypt. |
| * @return encrypted message. |
| */ |
| public @NonNull abstract byte[] encryptMessageToReader(@NonNull byte[] messagePlaintext); |
| |
| /** |
| * Decrypt a message received from the reader. |
| * |
| * <p>Do not use. In this version of the API, this method produces an incorrect |
| * result. Instead, applications should implement message encryption/decryption themselves as |
| * detailed in the {@link #createEphemeralKeyPair()} method. In a future API-level, this |
| * method will be deprecated. |
| * |
| * @param messageCiphertext encrypted message to decrypt. |
| * @return decrypted message. |
| * @throws MessageDecryptionException if the ciphertext couldn't be decrypted. |
| */ |
| public @NonNull abstract byte[] decryptMessageFromReader(@NonNull byte[] messageCiphertext) |
| throws MessageDecryptionException; |
| |
| /** |
| * Gets the X.509 certificate chain for the CredentialKey which identifies this |
| * credential to the issuing authority. This is the same certificate chain that |
| * was returned by {@link WritableIdentityCredential#getCredentialKeyCertificateChain(byte[])} |
| * when the credential was first created and its Android Keystore extension will |
| * contain the <code>challenge</code> data set at that time. See the documentation |
| * for that method for important information about this certificate chain. |
| * |
| * @return the certificate chain for this credential's CredentialKey. |
| */ |
| public @NonNull abstract Collection<X509Certificate> getCredentialKeyCertificateChain(); |
| |
| /** |
| * Sets whether to allow using an authentication key which use count has been exceeded if no |
| * other key is available. This must be called prior to calling |
| * {@link #getEntries(byte[], Map, byte[], byte[])}. |
| * |
| * By default this is set to true. |
| * |
| * @param allowUsingExhaustedKeys whether to allow using an authentication key which use count |
| * has been exceeded if no other key is available. |
| */ |
| public abstract void setAllowUsingExhaustedKeys(boolean allowUsingExhaustedKeys); |
| |
| /** |
| * Sets whether to allow using an authentication key which has been expired if no |
| * other key is available. This must be called prior to calling |
| * {@link #getEntries(byte[], Map, byte[], byte[])}. |
| * |
| * <p>By default this is set to false. |
| * |
| * <p>This is only implemented in feature version 202101 or later. If not implemented, the call |
| * fails with {@link UnsupportedOperationException}. See |
| * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known |
| * feature versions. |
| * |
| * @param allowUsingExpiredKeys whether to allow using an authentication key which use count |
| * has been exceeded if no other key is available. |
| */ |
| public void setAllowUsingExpiredKeys(boolean allowUsingExpiredKeys) { |
| throw new UnsupportedOperationException(); |
| } |
| |
| /** |
| * Called by android.hardware.biometrics.CryptoObject#getOpId() to get an |
| * operation handle. |
| * |
| * @hide |
| */ |
| public abstract long getCredstoreOperationHandle(); |
| |
| /** |
| * Retrieve data entries and associated data from this {@code IdentityCredential}. |
| * |
| * <p>If an access control check fails for one of the requested entries or if the entry |
| * doesn't exist, the entry is simply not returned. The application can detect this |
| * by using the {@link ResultData#getStatus(String, String)} method on each of the requested |
| * entries. |
| * |
| * <p>It is the responsibility of the calling application to know if authentication is needed |
| * and use e.g. {@link android.hardware.biometrics.BiometricPrompt} to make the user |
| * authenticate using a {@link android.hardware.biometrics.BiometricPrompt.CryptoObject} which |
| * references this object. If needed, this must be done before calling |
| * {@link #getEntries(byte[], Map, byte[], byte[])}. |
| * |
| * <p>It is permissible to call this method multiple times using the same instance but if this |
| * is done, the {@code sessionTranscript} parameter must be identical for each call. If this is |
| * not the case, the {@link SessionTranscriptMismatchException} exception is thrown. |
| * |
| * <p>If not {@code null} the {@code requestMessage} parameter must contain data for the request |
| * from the verifier. The content can be defined in the way appropriate for the credential, byt |
| * there are three requirements that must be met to work with this API: |
| * <ul> |
| * <li>The content must be a CBOR-encoded structure.</li> |
| * <li>The CBOR structure must be a map.</li> |
| * <li>The map must contain a tstr key "nameSpaces" whose value contains a map, as described in |
| * the example below.</li> |
| * </ul> |
| * |
| * <p>If these requirements are not met the {@link InvalidRequestMessageException} exception |
| * is thrown. |
| * |
| * <p>Here's an example of CBOR which conforms to this requirement: |
| * <pre> |
| * ItemsRequest = { |
| * ? "docType" : DocType, |
| * "nameSpaces" : NameSpaces, |
| * ? "RequestInfo" : {* tstr => any} ; Additional info the reader wants to provide |
| * } |
| * |
| * DocType = tstr |
| * |
| * NameSpaces = { |
| * + NameSpace => DataElements ; Requested data elements for each NameSpace |
| * } |
| * |
| * NameSpace = tstr |
| * |
| * DataElements = { |
| * + DataElement => IntentToRetain |
| * } |
| * |
| * DataElement = tstr |
| * IntentToRetain = bool |
| * </pre> |
| * |
| * <p>If the {@code sessionTranscript} parameter is not {@code null}, the X and Y coordinates |
| * of the public part of the key-pair previously generated by {@link #createEphemeralKeyPair()} |
| * must appear somewhere in the bytes of the CBOR. Each of these coordinates must appear |
| * encoded with the most significant bits first and use the exact amount of bits indicated by |
| * the key size of the ephemeral keys. For example, if the ephemeral key is using the P-256 |
| * curve then the 32 bytes for the X coordinate encoded with the most significant bits first |
| * must appear somewhere in {@code sessionTranscript} and ditto for the 32 bytes for the Y |
| * coordinate. |
| * |
| * <p>If {@code readerAuth} is not {@code null} it must be the bytes of a {@code COSE_Sign1} |
| * structure as defined in RFC 8152. For the payload nil shall be used and the |
| * detached payload is the ReaderAuthenticationBytes CBOR described below. |
| * <pre> |
| * ReaderAuthentication = [ |
| * "ReaderAuthentication", |
| * SessionTranscript, |
| * ItemsRequestBytes |
| * ] |
| * |
| * ItemsRequestBytes = #6.24(bstr .cbor ItemsRequest) |
| * |
| * ReaderAuthenticationBytes = #6.24(bstr .cbor ReaderAuthentication) |
| * </pre> |
| * |
| * <p>where {@code ItemsRequestBytes} are the bytes in the {@code requestMessage} parameter. |
| * |
| * <p>The public key corresponding to the key used to make the signature, can be found in the |
| * {@code x5chain} unprotected header element of the {@code COSE_Sign1} structure (as as |
| * described in |
| * <a href="https://tools.ietf.org/html/draft-ietf-cose-x509-04">draft-ietf-cose-x509-04</a>). |
| * There will be at least one certificate in said element and there may be more (and if so, |
| * each certificate must be signed by its successor). |
| * |
| * <p>Data elements protected by reader authentication are returned if, and only if, they are |
| * mentioned in {@code requestMessage}, {@code requestMessage} is signed by the top-most |
| * certificate in the reader's certificate chain, and the data element is configured |
| * with an {@link AccessControlProfile} configured with an X.509 certificate which appears |
| * in the certificate chain. |
| * |
| * <p>Note that only items referenced in {@code entriesToRequest} are returned - the |
| * {@code requestMessage} parameter is used only for enforcing reader authentication. |
| * |
| * <p>The reason for having {@code requestMessage} and {@code entriesToRequest} as separate |
| * parameters is that the former represents a request from the remote verifier device |
| * (optionally signed) and this allows the application to filter the request to not include |
| * data elements which the user has not consented to sharing. |
| * |
| * @param requestMessage If not {@code null}, must contain CBOR data conforming to |
| * the schema mentioned above. |
| * @param entriesToRequest The entries to request, organized as a map of namespace |
| * names with each value being a collection of data elements |
| * in the given namespace. |
| * @param readerSignature A {@code COSE_Sign1} structure as described above or |
| * {@code null} if reader authentication is not being used. |
| * @return A {@link ResultData} object containing entry data organized by namespace and a |
| * cryptographically authenticated representation of the same data. |
| * @throws SessionTranscriptMismatchException Thrown when trying use multiple different |
| * session transcripts. |
| * @throws NoAuthenticationKeyAvailableException if authentication keys were never |
| * provisioned, the method |
| * {@link #setAvailableAuthenticationKeys(int, int)} |
| * was called with {@code keyCount} set to 0, |
| * the method |
| * {@link #setAllowUsingExhaustedKeys(boolean)} |
| * was called with {@code false} and all |
| * available authentication keys have been |
| * exhausted. |
| * @throws InvalidReaderSignatureException if the reader signature is invalid, or it |
| * doesn't contain a certificate chain, or if |
| * the signature failed to validate. |
| * @throws InvalidRequestMessageException if the requestMessage is malformed. |
| * @throws EphemeralPublicKeyNotFoundException if the ephemeral public key was not found in |
| * the session transcript. |
| */ |
| public abstract @NonNull ResultData getEntries( |
| @Nullable byte[] requestMessage, |
| @NonNull Map<String, Collection<String>> entriesToRequest, |
| @Nullable byte[] sessionTranscript, |
| @Nullable byte[] readerSignature) |
| throws SessionTranscriptMismatchException, NoAuthenticationKeyAvailableException, |
| InvalidReaderSignatureException, EphemeralPublicKeyNotFoundException, |
| InvalidRequestMessageException; |
| |
| /** |
| * Sets the number of dynamic authentication keys the {@code IdentityCredential} will maintain, |
| * and the number of times each should be used. |
| * |
| * <p>The Identity Credential system will select the least-used dynamic authentication key each |
| * time {@link #getEntries(byte[], Map, byte[], byte[])} is called. Identity Credentials |
| * for which this method has not been called behave as though it had been called wit |
| * {@code keyCount} 0 and {@code maxUsesPerKey} 1. |
| * |
| * @param keyCount The number of active, certified dynamic authentication keys the |
| * {@code IdentityCredential} will try to keep available. This value |
| * must be non-negative. |
| * @param maxUsesPerKey The maximum number of times each of the keys will be used before it's |
| * eligible for replacement. This value must be greater than zero. |
| */ |
| public abstract void setAvailableAuthenticationKeys(int keyCount, int maxUsesPerKey); |
| |
| /** |
| * Gets a collection of dynamic authentication keys that need certification. |
| * |
| * <p>When there aren't enough certified dynamic authentication keys, either because the key |
| * count has been increased or because one or more keys have reached their usage count, this |
| * method will generate replacement keys and certificates and return them for issuer |
| * certification. The issuer certificates and associated static authentication data must then |
| * be provided back to the Identity Credential using |
| * {@link #storeStaticAuthenticationData(X509Certificate, byte[])}. The private part of |
| * each authentication key never leaves secure hardware. |
| * |
| * <p>Each X.509 certificate is signed by CredentialKey. The certificate chain for CredentialKey |
| * can be obtained using the {@link #getCredentialKeyCertificateChain()} method. |
| |
| * <p>If the implementation is feature version 202101 or later, |
| * each X.509 certificate contains an X.509 extension at OID 1.3.6.1.4.1.11129.2.1.26 which |
| * contains a DER encoded OCTET STRING with the bytes of the CBOR with the following CDDL: |
| * <pre> |
| * ProofOfBinding = [ |
| * "ProofOfBinding", |
| * bstr, // Contains SHA-256(ProofOfProvisioning) |
| * ] |
| * </pre> |
| * <p>This CBOR enables an issuer to determine the exact state of the credential it |
| * returns issuer-signed data for. |
| * |
| * <p> See {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for |
| * known feature versions. |
| * |
| * @return A collection of X.509 certificates for dynamic authentication keys that need issuer |
| * certification. |
| */ |
| public @NonNull abstract Collection<X509Certificate> getAuthKeysNeedingCertification(); |
| |
| /** |
| * Store authentication data associated with a dynamic authentication key. |
| * |
| * This should only be called for an authenticated key returned by |
| * {@link #getAuthKeysNeedingCertification()}. |
| * |
| * @param authenticationKey The dynamic authentication key for which certification and |
| * associated static |
| * authentication data is being provided. |
| * @param staticAuthData Static authentication data provided by the issuer that validates |
| * the authenticity |
| * and integrity of the credential data fields. |
| * @throws UnknownAuthenticationKeyException If the given authentication key is not recognized. |
| * @deprecated Use {@link #storeStaticAuthenticationData(X509Certificate, Instant, byte[])} |
| * instead. |
| */ |
| @Deprecated |
| public abstract void storeStaticAuthenticationData( |
| @NonNull X509Certificate authenticationKey, |
| @NonNull byte[] staticAuthData) |
| throws UnknownAuthenticationKeyException; |
| |
| /** |
| * Store authentication data associated with a dynamic authentication key. |
| * |
| * This should only be called for an authenticated key returned by |
| * {@link #getAuthKeysNeedingCertification()}. |
| * |
| * <p>This is only implemented in feature version 202101 or later. If not implemented, the call |
| * fails with {@link UnsupportedOperationException}. See |
| * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known |
| * feature versions. |
| * |
| * @param authenticationKey The dynamic authentication key for which certification and |
| * associated static |
| * authentication data is being provided. |
| * @param expirationDate The expiration date of the static authentication data. |
| * @param staticAuthData Static authentication data provided by the issuer that validates |
| * the authenticity |
| * and integrity of the credential data fields. |
| * @throws UnknownAuthenticationKeyException If the given authentication key is not recognized. |
| */ |
| public void storeStaticAuthenticationData( |
| @NonNull X509Certificate authenticationKey, |
| @NonNull Instant expirationDate, |
| @NonNull byte[] staticAuthData) |
| throws UnknownAuthenticationKeyException { |
| throw new UnsupportedOperationException(); |
| } |
| |
| /** |
| * Get the number of times the dynamic authentication keys have been used. |
| * |
| * @return int array of dynamic authentication key usage counts. |
| */ |
| public @NonNull abstract int[] getAuthenticationDataUsageCount(); |
| |
| /** |
| * Proves ownership of a credential. |
| * |
| * <p>This method returns a COSE_Sign1 data structure signed by the CredentialKey |
| * with payload set to {@code ProofOfDeletion} as defined below.</p> |
| * |
| * <p>The returned CBOR is the following:</p> |
| * <pre> |
| * ProofOfOwnership = [ |
| * "ProofOfOwnership", ; tstr |
| * tstr, ; DocType |
| * bstr, ; Challenge |
| * bool ; true if this is a test credential, should |
| * ; always be false. |
| * ] |
| * </pre> |
| * |
| * <p>This is only implemented in feature version 202101 or later. If not implemented, the call |
| * fails with {@link UnsupportedOperationException}. See |
| * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known |
| * feature versions. |
| * |
| * @param challenge is a non-empty byte array whose contents should be unique, fresh and |
| * provided by the issuing authority. The value provided is embedded in the |
| * generated CBOR and enables the issuing authority to verify that the |
| * returned proof is fresh. |
| * @return the COSE_Sign1 data structure above |
| */ |
| public @NonNull byte[] proveOwnership(@NonNull byte[] challenge) { |
| throw new UnsupportedOperationException(); |
| } |
| |
| /** |
| * Deletes a credential. |
| * |
| * <p>This method returns a COSE_Sign1 data structure signed by the CredentialKey |
| * with payload set to {@code ProofOfDeletion} as defined below.</p> |
| * |
| * <pre> |
| * ProofOfDeletion = [ |
| * "ProofOfDeletion", ; tstr |
| * tstr, ; DocType |
| * bstr, ; Challenge |
| * bool ; true if this is a test credential, should |
| * ; always be false. |
| * ] |
| * </pre> |
| * |
| * <p>This is only implemented in feature version 202101 or later. If not implemented, the call |
| * fails with {@link UnsupportedOperationException}. See |
| * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known |
| * feature versions. |
| * |
| * @param challenge is a non-empty byte array whose contents should be unique, fresh and |
| * provided by the issuing authority. The value provided is embedded in the |
| * generated CBOR and enables the issuing authority to verify that the |
| * returned proof is fresh. |
| * @return the COSE_Sign1 data structure above |
| */ |
| public @NonNull byte[] delete(@NonNull byte[] challenge) { |
| throw new UnsupportedOperationException(); |
| } |
| |
| /** |
| * Updates the credential with new access control profiles and data items. |
| * |
| * <p>This method is similar to |
| * {@link WritableIdentityCredential#personalize(PersonalizationData)} except that it operates |
| * on an existing credential, see the documentation for that method for the format of the |
| * returned data. |
| * |
| * <p>If this call succeeds an side-effect is that all dynamic authentication keys for the |
| * credential are deleted. The application will need to use |
| * {@link #getAuthKeysNeedingCertification()} to generate replacement keys and return |
| * them for issuer certification. |
| * |
| * <p>This is only implemented in feature version 202101 or later. If not implemented, the call |
| * fails with {@link UnsupportedOperationException}. See |
| * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known |
| * feature versions. |
| * |
| * @param personalizationData The data to update, including access control profiles |
| * and data elements and their values, grouped into namespaces. |
| * @return A COSE_Sign1 data structure, see above. |
| */ |
| public @NonNull byte[] update(@NonNull PersonalizationData personalizationData) { |
| throw new UnsupportedOperationException(); |
| } |
| } |